Products 939757-32-1

CAS 939757-32-1 is the registry number for 3-Hydroxy-3-(2-thienyl)propyl)methylcarbamic Acid 1,1-Dimethylethyl Ester. Offered by: TRC. Available pack sizes: 100mg, 10mg, 25mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-(3-hydroxy-3-thiophen-2-ylpropyl)-N-methylcarbamate (CAS 939757-32-1) is a chemical compound with the molecular formula C13H21NO3S and a molecular weight of 271.38 g/mol. IUPAC name: tert-butyl N-(3-hydroxy-3-thiophen-2-ylpropyl)-N-methylcarbamate. InChIKey: ZBJUPUZPFGMEOC-UHFFFAOYSA-N.

Identity
Molecular formulaC13H21NO3S
Molecular weight271.38 g/mol
IUPAC nametert-butyl N-(3-hydroxy-3-thiophen-2-ylpropyl)-N-methylcarbamate
InChIKeyZBJUPUZPFGMEOC-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N(C)CCC(C1=CC=CS1)O

Computed by PubChem (NCBI)