Products 172947-19-2
CAS 172947-19-2 appears in our catalog under these names: (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-((2-cyclopropylpropan-2-yl)amino)-4-oxobutanoic acid, 98%, Fmoc-Asn(dmcp)-OH 1 g, Fmoc-Asn(dmcp)-OH 5 g. Offered by: Chemat Brand, Sigma-Aldrich. Available pack sizes: on request, 1 G, 5 G.
(2S)-4-(2-cyclopropylpropan-2-ylamino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoic acid (CAS 172947-19-2) is a chemical compound with the molecular formula C25H28N2O5 and a molecular weight of 436.5 g/mol. IUPAC name: (2S)-4-(2-cyclopropylpropan-2-ylamino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoic acid. InChIKey: XJQSVBZBGZBJDP-NRFANRHFSA-N.
| Molecular formula | C25H28N2O5 |
|---|---|
| Molecular weight | 436.5 g/mol |
| IUPAC name | (2S)-4-(2-cyclopropylpropan-2-ylamino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoic acid |
| InChIKey | XJQSVBZBGZBJDP-NRFANRHFSA-N |
| SMILES | CC(C)(C1CC1)NC(=O)C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)