Products 889675-08-5

CAS 889675-08-5 is the registry number for tert-Butyl 2-(3-(2-amino-2-oxoacetyl)-1-benzyl-2-ethyl-1H-indol-4-yloxy)acetate. Offered by: Biosynth. Available pack sizes: 100mg, 250mg, 500mg.

Structural formula: {0} (CAS {1})

Tert-butyl 2-(1-benzyl-2-ethyl-3-oxamoylindol-4-yl)oxyacetate (CAS 889675-08-5) is a chemical compound with the molecular formula C25H28N2O5 and a molecular weight of 436.5 g/mol. IUPAC name: tert-butyl 2-(1-benzyl-2-ethyl-3-oxamoylindol-4-yl)oxyacetate. InChIKey: BZBUAIWSQULJSV-UHFFFAOYSA-N.

Identity
Molecular formulaC25H28N2O5
Molecular weight436.5 g/mol
IUPAC nametert-butyl 2-(1-benzyl-2-ethyl-3-oxamoylindol-4-yl)oxyacetate
InChIKeyBZBUAIWSQULJSV-UHFFFAOYSA-N
SMILESCCC1=C(C2=C(N1CC3=CC=CC=C3)C=CC=C2OCC(=O)OC(C)(C)C)C(=O)C(=O)N

Computed by PubChem (NCBI)