CAS 173098-06-1 appears in our catalog under these names: Isoguanosine Triacetate, 2',3',5'-Tri-O-acetylisoguanosine. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 100mg, 1g, 50mg.
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(6-amino-2-oxo-1H-purin-9-yl)oxolan-2-yl]methyl acetate (CAS 173098-06-1) is a chemical compound with the molecular formula C16H19N5O8 and a molecular weight of 409.35 g/mol. IUPAC name: [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(6-amino-2-oxo-1H-purin-9-yl)oxolan-2-yl]methyl acetate. InChIKey: QHMGQUDDESFBBM-SDBHATRESA-N.
| Molecular formula | C16H19N5O8 |
|---|---|
| Molecular weight | 409.35 g/mol |
| IUPAC name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(6-amino-2-oxo-1H-purin-9-yl)oxolan-2-yl]methyl acetate |
| InChIKey | QHMGQUDDESFBBM-SDBHATRESA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=NC3=C(NC(=O)N=C32)N)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)