CAS 6979-94-8 appears in our catalog under these names: Ribavirin Impurity 12, 2’,3’,5’-Tri-O-acetyl Guanosine, 2',3',5'–Tri–O–acetylguanosine, 2',3',5'-Tri-O-acetylguanosine, 2',3',5'-Tri-O-acetylguanosine, >98.0%(HPLC)(T). Offered by: Chemat Brand, TRC, GLPBio, Biosynth, TCI. Available pack sizes: on request, 5g, 100g, 25g, 500g, 50g, 1g, 250g.
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl acetate (CAS 6979-94-8) is a chemical compound with the molecular formula C16H19N5O8 and a molecular weight of 409.35 g/mol. IUPAC name: [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl acetate. InChIKey: ULXDFYDZZFYGIY-SDBHATRESA-N.
| Molecular formula | C16H19N5O8 |
|---|---|
| Molecular weight | 409.35 g/mol |
| IUPAC name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl acetate |
| InChIKey | ULXDFYDZZFYGIY-SDBHATRESA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=NC3=C2N=C(NC3=O)N)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)