CAS 173276-79-4 is the registry number for 2-(2,3-Difluorophenyl)propan-2-ol, 97%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
2-(2,3-difluorophenyl)propan-2-ol (CAS 173276-79-4) is a chemical compound with the molecular formula C9H10F2O and a molecular weight of 172.17 g/mol. IUPAC name: 2-(2,3-difluorophenyl)propan-2-ol. InChIKey: DTGNXTRDHBEUDS-UHFFFAOYSA-N.
| Molecular formula | C9H10F2O |
|---|---|
| Molecular weight | 172.17 g/mol |
| IUPAC name | 2-(2,3-difluorophenyl)propan-2-ol |
| InChIKey | DTGNXTRDHBEUDS-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=C(C(=CC=C1)F)F)O |
Computed by PubChem (NCBI)