Products 173293-35-1
CAS 173293-35-1 is the registry number for Triptonoterpene Me ether. Offered by: MedChemExpress. Available pack sizes: 5 mg, 1 mg, 10 mg.
(4aS,10aR)-8-methoxy-1,1,4a-trimethyl-7-propan-2-yl-4,9,10,10a-tetrahydro-3H-phenanthren-2-one (CAS 173293-35-1) is a chemical compound with the molecular formula C21H30O2 and a molecular weight of 314.5 g/mol. IUPAC name: (4aS,10aR)-8-methoxy-1,1,4a-trimethyl-7-propan-2-yl-4,9,10,10a-tetrahydro-3H-phenanthren-2-one. InChIKey: KYKRDPYDEHBXPN-LAUBAEHRSA-N.
| Molecular formula | C21H30O2 |
|---|---|
| Molecular weight | 314.5 g/mol |
| IUPAC name | (4aS,10aR)-8-methoxy-1,1,4a-trimethyl-7-propan-2-yl-4,9,10,10a-tetrahydro-3H-phenanthren-2-one |
| InChIKey | KYKRDPYDEHBXPN-LAUBAEHRSA-N |
| SMILES | CC(C)C1=C(C2=C(C=C1)[C@]3(CCC(=O)C([C@@H]3CC2)(C)C)C)OC |
Computed by PubChem (NCBI)