CAS 173326-85-7 is the registry number for 9,11-di-cis-Retinoic Acid. Offered by: Chemat Brand. Available pack sizes: on request.
(2E,4Z,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoic acid (CAS 173326-85-7) is a chemical compound with the molecular formula C20H28O2 and a molecular weight of 300.4 g/mol. IUPAC name: (2E,4Z,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoic acid. InChIKey: SHGAZHPCJJPHSC-ZPJAGTIHSA-N.
| Molecular formula | C20H28O2 |
|---|---|
| Molecular weight | 300.4 g/mol |
| IUPAC name | (2E,4Z,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoic acid |
| InChIKey | SHGAZHPCJJPHSC-ZPJAGTIHSA-N |
| SMILES | CC1=C(C(CCC1)(C)C)/C=C/C(=C\C=C/C(=C/C(=O)O)/C)/C |
Computed by PubChem (NCBI)