CAS 2322-77-2 appears in our catalog under these names: Levonorgestrel EP Impurity R, Levonorgestrel Impurity 18(Levonorgestrel EP Impurity R), Methoxygonadiene (>90%), Methoxygonadiene, Methoxydienone. Offered by: Chemat Brand, Hubei YoungXin, TRC, GLPBio, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 10g, 1g.
(8R,9S,13S,14S)-13-ethyl-3-methoxy-4,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-one (CAS 2322-77-2) is a chemical compound with the molecular formula C20H28O2 and a molecular weight of 300.4 g/mol. IUPAC name: (8R,9S,13S,14S)-13-ethyl-3-methoxy-4,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-one. InChIKey: PQMRKLSVUBRLLQ-XSYGEPLQSA-N.
| Molecular formula | C20H28O2 |
|---|---|
| Molecular weight | 300.4 g/mol |
| IUPAC name | (8R,9S,13S,14S)-13-ethyl-3-methoxy-4,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-one |
| InChIKey | PQMRKLSVUBRLLQ-XSYGEPLQSA-N |
| SMILES | CC[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)CCC4=C3CC=C(C4)OC |
Computed by PubChem (NCBI)