Products 173485-82-0

CAS 173485-82-0 is the registry number for Pelagiomicin C. Offered by: MedChemExpress. Available pack sizes: Get quote.

Structural formula: {0} (CAS {1})

6-[(2-aminoacetyl)oxymethyl]-9-methoxyphenazine-1-carboxylic acid (CAS 173485-82-0) is a chemical compound with the molecular formula C17H15N3O5 and a molecular weight of 341.32 g/mol. IUPAC name: 6-[(2-aminoacetyl)oxymethyl]-9-methoxyphenazine-1-carboxylic acid. InChIKey: QYYNGHDLTPGQCH-UHFFFAOYSA-N.

Identity
Molecular formulaC17H15N3O5
Molecular weight341.32 g/mol
IUPAC name6-[(2-aminoacetyl)oxymethyl]-9-methoxyphenazine-1-carboxylic acid
InChIKeyQYYNGHDLTPGQCH-UHFFFAOYSA-N
SMILESCOC1=CC=C(C2=NC3=CC=CC(=C3N=C12)C(=O)O)COC(=O)CN

Computed by PubChem (NCBI)