CAS 2416132-70-0 is the registry number for Thalidomide-azetidine-CHO. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]azetidine-3-carbaldehyde (CAS 2416132-70-0) is a chemical compound with the molecular formula C17H15N3O5 and a molecular weight of 341.32 g/mol. IUPAC name: 1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]azetidine-3-carbaldehyde. InChIKey: DDKDMZOBOREUIY-UHFFFAOYSA-N.
| Molecular formula | C17H15N3O5 |
|---|---|
| Molecular weight | 341.32 g/mol |
| IUPAC name | 1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]azetidine-3-carbaldehyde |
| InChIKey | DDKDMZOBOREUIY-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C=C(C=C3)N4CC(C4)C=O |
Computed by PubChem (NCBI)