CAS 17361-89-6 is the registry number for 5-Phenyl-2-thiophenecarbonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
5-phenylthiophene-2-carbonyl chloride (CAS 17361-89-6) is a chemical compound with the molecular formula C11H7ClOS and a molecular weight of 222.69 g/mol. IUPAC name: 5-phenylthiophene-2-carbonyl chloride. InChIKey: DAQWIBBCMYIUFA-UHFFFAOYSA-N.
| Molecular formula | C11H7ClOS |
|---|---|
| Molecular weight | 222.69 g/mol |
| IUPAC name | 5-phenylthiophene-2-carbonyl chloride |
| InChIKey | DAQWIBBCMYIUFA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(S2)C(=O)Cl |
Computed by PubChem (NCBI)