Products 17361-89-6

CAS 17361-89-6 is the registry number for 5-Phenyl-2-thiophenecarbonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

5-phenylthiophene-2-carbonyl chloride (CAS 17361-89-6) is a chemical compound with the molecular formula C11H7ClOS and a molecular weight of 222.69 g/mol. IUPAC name: 5-phenylthiophene-2-carbonyl chloride. InChIKey: DAQWIBBCMYIUFA-UHFFFAOYSA-N.

Identity
Molecular formulaC11H7ClOS
Molecular weight222.69 g/mol
IUPAC name5-phenylthiophene-2-carbonyl chloride
InChIKeyDAQWIBBCMYIUFA-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=CC=C(S2)C(=O)Cl

Computed by PubChem (NCBI)