CAS 893736-71-5 is the registry number for 2-Thiophenecarboxaldehyde, 4-(4-chlorophenyl)-, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-(4-chlorophenyl)thiophene-2-carbaldehyde (CAS 893736-71-5) is a chemical compound with the molecular formula C11H7ClOS and a molecular weight of 222.69 g/mol. IUPAC name: 4-(4-chlorophenyl)thiophene-2-carbaldehyde. InChIKey: MWCDXOIPVFKGJT-UHFFFAOYSA-N.
| Molecular formula | C11H7ClOS |
|---|---|
| Molecular weight | 222.69 g/mol |
| IUPAC name | 4-(4-chlorophenyl)thiophene-2-carbaldehyde |
| InChIKey | MWCDXOIPVFKGJT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CSC(=C2)C=O)Cl |
Computed by PubChem (NCBI)