Products 173665-70-8

CAS 173665-70-8 is the registry number for Methyl 2-(2-((2,5-Dimethylphenoxy)methyl)phenyl)-2-(hydroxy)acetic Acid Ester. Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.

Structural formula: {0} (CAS {1})

Methyl 2-[2-[(2,5-dimethylphenoxy)methyl]phenyl]-2-hydroxyacetate (CAS 173665-70-8) is a chemical compound with the molecular formula C18H20O4 and a molecular weight of 300.3 g/mol. IUPAC name: methyl 2-[2-[(2,5-dimethylphenoxy)methyl]phenyl]-2-hydroxyacetate. InChIKey: RGYLIPNFLBVTQG-UHFFFAOYSA-N.

Identity
Molecular formulaC18H20O4
Molecular weight300.3 g/mol
IUPAC namemethyl 2-[2-[(2,5-dimethylphenoxy)methyl]phenyl]-2-hydroxyacetate
InChIKeyRGYLIPNFLBVTQG-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1)C)OCC2=CC=CC=C2C(C(=O)OC)O

Computed by PubChem (NCBI)