Products 173678-77-8
CAS 173678-77-8 is the registry number for Pyrene, 1,6-diethynyl-, 95%. Offered by: Chemat. Available pack sizes: 1g.
1,6-diethynylpyrene (CAS 173678-77-8) is a chemical compound with the molecular formula C20H10 and a molecular weight of 250.3 g/mol. IUPAC name: 1,6-diethynylpyrene. InChIKey: ANAJYRYWCSPFKM-UHFFFAOYSA-N.
| Molecular formula | C20H10 |
|---|---|
| Molecular weight | 250.3 g/mol |
| IUPAC name | 1,6-diethynylpyrene |
| InChIKey | ANAJYRYWCSPFKM-UHFFFAOYSA-N |
| SMILES | C#CC1=C2C=CC3=C4C2=C(C=C1)C=CC4=C(C=C3)C#C |
Computed by PubChem (NCBI)
Synonyms:
Pyrene, 1,6-diethynyl-