Products 5821-51-2
CAS 5821-51-2 appears in our catalog under these names: Corannulene, 95%, Corannulene, Dibenzo(ghi,mno)fluoranthene, 97%, Corannulene, >97.0%(GC), Dibenzo[ghi,mno]fluoranthene, 97%, 97%. Offered by: Combi-blocks, Chemat Brand, AmBeed, GLPBio, TCI. Available pack sizes: 100mg, on request, 1g, 250mg, 25mg, 20mg, 50mg, 10 mg.
Hexacyclo[11.5.2.04,17.07,16.010,15.014,18]icosa-1(18),2,4(17),5,7(16),8,10(15),11,13,19-decaene (CAS 5821-51-2) is a chemical compound with the molecular formula C20H10 and a molecular weight of 250.3 g/mol. IUPAC name: hexacyclo[11.5.2.04,17.07,16.010,15.014,18]icosa-1(18),2,4(17),5,7(16),8,10(15),11,13,19-decaene. InChIKey: VXRUJZQPKRBJKH-UHFFFAOYSA-N.
| Molecular formula | C20H10 |
|---|---|
| Molecular weight | 250.3 g/mol |
| IUPAC name | hexacyclo[11.5.2.04,17.07,16.010,15.014,18]icosa-1(18),2,4(17),5,7(16),8,10(15),11,13,19-decaene |
| InChIKey | VXRUJZQPKRBJKH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C4=C1C=CC5=C4C6=C(C=C5)C=CC(=C36)C=C2 |
Computed by PubChem (NCBI)