Products 17380-80-2
CAS 17380-80-2 is the registry number for 1-(4-Fluorophenyl)cyclohexan-1-amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(4-fluorophenyl)cyclohexan-1-amine (CAS 17380-80-2) is a chemical compound with the molecular formula C12H16FN and a molecular weight of 193.26 g/mol. IUPAC name: 1-(4-fluorophenyl)cyclohexan-1-amine. InChIKey: SWHLYGWSQYSQBX-UHFFFAOYSA-N.
| Molecular formula | C12H16FN |
|---|---|
| Molecular weight | 193.26 g/mol |
| IUPAC name | 1-(4-fluorophenyl)cyclohexan-1-amine |
| InChIKey | SWHLYGWSQYSQBX-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(C2=CC=C(C=C2)F)N |
Computed by PubChem (NCBI)