CAS 173843-58-8 is the registry number for 6-Methyl-3-(piperidin-4-yl)benzo[d] oxazol-2(3h)-one hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 5g.
6-methyl-3-piperidin-4-yl-1,3-benzoxazol-2-one;hydrochloride (CAS 173843-58-8) is a chemical compound with the molecular formula C13H17ClN2O2 and a molecular weight of 268.74 g/mol. IUPAC name: 6-methyl-3-piperidin-4-yl-1,3-benzoxazol-2-one;hydrochloride. InChIKey: OKUFXXLCSFLJAX-UHFFFAOYSA-N.
| Molecular formula | C13H17ClN2O2 |
|---|---|
| Molecular weight | 268.74 g/mol |
| IUPAC name | 6-methyl-3-piperidin-4-yl-1,3-benzoxazol-2-one;hydrochloride |
| InChIKey | OKUFXXLCSFLJAX-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N(C(=O)O2)C3CCNCC3.Cl |
Computed by PubChem (NCBI)