Products 17387-32-5

CAS 17387-32-5 appears in our catalog under these names: Alprazolam Impurity 15, Alprazolam Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

N-(2-benzoyl-4-chlorophenyl)-2,2-dichloroacetamide (CAS 17387-32-5) is a chemical compound with the molecular formula C15H10Cl3NO2 and a molecular weight of 342.6 g/mol. IUPAC name: N-(2-benzoyl-4-chlorophenyl)-2,2-dichloroacetamide. InChIKey: RSZLFJSGIRUKCA-UHFFFAOYSA-N.

Identity
Molecular formulaC15H10Cl3NO2
Molecular weight342.6 g/mol
IUPAC nameN-(2-benzoyl-4-chlorophenyl)-2,2-dichloroacetamide
InChIKeyRSZLFJSGIRUKCA-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C(=O)C2=C(C=CC(=C2)Cl)NC(=O)C(Cl)Cl

Computed by PubChem (NCBI)