CAS 17387-32-5 appears in our catalog under these names: Alprazolam Impurity 15, Alprazolam Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
N-(2-benzoyl-4-chlorophenyl)-2,2-dichloroacetamide (CAS 17387-32-5) is a chemical compound with the molecular formula C15H10Cl3NO2 and a molecular weight of 342.6 g/mol. IUPAC name: N-(2-benzoyl-4-chlorophenyl)-2,2-dichloroacetamide. InChIKey: RSZLFJSGIRUKCA-UHFFFAOYSA-N.
| Molecular formula | C15H10Cl3NO2 |
|---|---|
| Molecular weight | 342.6 g/mol |
| IUPAC name | N-(2-benzoyl-4-chlorophenyl)-2,2-dichloroacetamide |
| InChIKey | RSZLFJSGIRUKCA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=C(C=CC(=C2)Cl)NC(=O)C(Cl)Cl |
Computed by PubChem (NCBI)