CAS 35382-88-8 is the registry number for N-(Benzoylphenyl)-2,2,2-trichloroacetamide. Offered by: TRC. Available pack sizes: 5g.
N-(2-benzoylphenyl)-2,2,2-trichloroacetamide (CAS 35382-88-8) is a chemical compound with the molecular formula C15H10Cl3NO2 and a molecular weight of 342.6 g/mol. IUPAC name: N-(2-benzoylphenyl)-2,2,2-trichloroacetamide. InChIKey: QIIQXSOGQOERHH-UHFFFAOYSA-N.
| Molecular formula | C15H10Cl3NO2 |
|---|---|
| Molecular weight | 342.6 g/mol |
| IUPAC name | N-(2-benzoylphenyl)-2,2,2-trichloroacetamide |
| InChIKey | QIIQXSOGQOERHH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=CC=C2NC(=O)C(Cl)(Cl)Cl |
Computed by PubChem (NCBI)