Products 174008-52-7
CAS 174008-52-7 is the registry number for ML10375. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[(3R,5S)-3,5-dimethylpiperidin-1-yl]ethyl 4-amino-5-chloro-2-methoxybenzoate (CAS 174008-52-7) is a chemical compound with the molecular formula C17H25ClN2O3 and a molecular weight of 340.8 g/mol. IUPAC name: 2-[(3R,5S)-3,5-dimethylpiperidin-1-yl]ethyl 4-amino-5-chloro-2-methoxybenzoate. InChIKey: BUEFUOFMOXJXAR-TXEJJXNPSA-N.
| Molecular formula | C17H25ClN2O3 |
|---|---|
| Molecular weight | 340.8 g/mol |
| IUPAC name | 2-[(3R,5S)-3,5-dimethylpiperidin-1-yl]ethyl 4-amino-5-chloro-2-methoxybenzoate |
| InChIKey | BUEFUOFMOXJXAR-TXEJJXNPSA-N |
| SMILES | C[C@@H]1C[C@@H](CN(C1)CCOC(=O)C2=CC(=C(C=C2OC)N)Cl)C |
Computed by PubChem (NCBI)