CAS 174092-82-1 appears in our catalog under these names: 2,3-Dihydro-6-isocyano-1,4-benzodioxine, 95%, 6-Isocyano-4-oxachromane, 95%, 6–Isocyano–2,3–dihydro–benzo(1,4)dioxine, 6-Isocyano-2,3-dihydro-benzo(1,4)dioxine, 2,3-Dihydro-6-Isocyano-1,4-Benzodioxine. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Thermo Scientific (Acros). Available pack sizes: 10g, 1g, 5g, 250mg, 50mg.
6-isocyano-2,3-dihydro-1,4-benzodioxine (CAS 174092-82-1) is a chemical compound with the molecular formula C9H7NO2 and a molecular weight of 161.16 g/mol. IUPAC name: 6-isocyano-2,3-dihydro-1,4-benzodioxine. InChIKey: AAUQOWLQNFIDQL-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2 |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 6-isocyano-2,3-dihydro-1,4-benzodioxine |
| InChIKey | AAUQOWLQNFIDQL-UHFFFAOYSA-N |
| SMILES | [C-]#[N+]C1=CC2=C(C=C1)OCCO2 |
Computed by PubChem (NCBI)