CAS 174152-47-7 is the registry number for 4-(4,6-Diphenyl-1,3,5-triazin-2-yl)aniline, 98%. Offered by: Chemat Brand. Available pack sizes: 250mg, 1g.
4-(4,6-diphenyl-1,3,5-triazin-2-yl)aniline (CAS 174152-47-7) is a chemical compound with the molecular formula C21H16N4 and a molecular weight of 324.4 g/mol. IUPAC name: 4-(4,6-diphenyl-1,3,5-triazin-2-yl)aniline. InChIKey: OFRZSDOXKFCVHD-UHFFFAOYSA-N.
| Molecular formula | C21H16N4 |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | 4-(4,6-diphenyl-1,3,5-triazin-2-yl)aniline |
| InChIKey | OFRZSDOXKFCVHD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NC(=N2)C3=CC=C(C=C3)N)C4=CC=CC=C4 |
Computed by PubChem (NCBI)