CAS 2258656-65-2 is the registry number for 2,4,6-Tri(pyridin-4-yl)aniline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4,6-tripyridin-4-ylaniline (CAS 2258656-65-2) is a chemical compound with the molecular formula C21H16N4 and a molecular weight of 324.4 g/mol. IUPAC name: 2,4,6-tripyridin-4-ylaniline. InChIKey: RGAUGAJFWVJDPE-UHFFFAOYSA-N.
| Molecular formula | C21H16N4 |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | 2,4,6-tripyridin-4-ylaniline |
| InChIKey | RGAUGAJFWVJDPE-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1C2=CC(=C(C(=C2)C3=CC=NC=C3)N)C4=CC=NC=C4 |
Computed by PubChem (NCBI)