Products 174175-30-5
CAS 174175-30-5 is the registry number for rel-(2R,3S)-5-tert-butoxycarbonyl-5-azaspiro[2.4]heptane-2-carboxylic acid, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
(2R,3S)-5-[(2-methylpropan-2-yl)oxycarbonyl]-5-azaspiro[2.4]heptane-2-carboxylic acid (CAS 174175-30-5) is a chemical compound with the molecular formula C12H19NO4 and a molecular weight of 241.28 g/mol. IUPAC name: (2R,3S)-5-[(2-methylpropan-2-yl)oxycarbonyl]-5-azaspiro[2.4]heptane-2-carboxylic acid. InChIKey: QXRGGYBREHVBNA-UFBFGSQYSA-N.
| Molecular formula | C12H19NO4 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | (2R,3S)-5-[(2-methylpropan-2-yl)oxycarbonyl]-5-azaspiro[2.4]heptane-2-carboxylic acid |
| InChIKey | QXRGGYBREHVBNA-UFBFGSQYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@]2(C1)C[C@H]2C(=O)O |
Computed by PubChem (NCBI)