CAS 174195-95-0 appears in our catalog under these names: tert-Butyl 3-oxocyclopentane-1-carboxylate, 95%, tert–butyl 3–oxocyclopentane–1–carboxylate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g, 25g.
Tert-butyl 3-oxocyclopentane-1-carboxylate (CAS 174195-95-0) is a chemical compound with the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. IUPAC name: tert-butyl 3-oxocyclopentane-1-carboxylate. InChIKey: VWGRUBYATPOSGE-UHFFFAOYSA-N.
| Molecular formula | C10H16O3 |
|---|---|
| Molecular weight | 184.23 g/mol |
| IUPAC name | tert-butyl 3-oxocyclopentane-1-carboxylate |
| InChIKey | VWGRUBYATPOSGE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1CCC(=O)C1 |
Computed by PubChem (NCBI)