CAS 99181-50-7 appears in our catalog under these names: 1,3,5-Adamantanetriol, 97%, 1,3,5–Adamantanetriol, Adamantane-1,3,5-triol, 97%, 97%, Adamantane-1,3,5-triol, 99.10%, Adamantane-1,3,5-triol, 98%. Offered by: Combi-blocks, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 10g, 1g, 5g, 250mg, 100mg, 25g, 100g, 1 g.
Adamantane-1,3,5-triol (CAS 99181-50-7) is a chemical compound with the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. IUPAC name: adamantane-1,3,5-triol. InChIKey: MCYBYTIPMYLHAK-UHFFFAOYSA-N.
| Molecular formula | C10H16O3 |
|---|---|
| Molecular weight | 184.23 g/mol |
| IUPAC name | adamantane-1,3,5-triol |
| InChIKey | MCYBYTIPMYLHAK-UHFFFAOYSA-N |
| SMILES | C1C2CC3(CC1(CC(C2)(C3)O)O)O |
Computed by PubChem (NCBI)