CAS 174213-52-6 appears in our catalog under these names: (S)-2-(Phenoxymethyl)pyrrolidine hydrochloride, 95%, (2S)-2-(Phenoxymethyl)pyrrolidine hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 100mg, 10g, 250mg, 5g, 1g.
(2S)-2-(phenoxymethyl)pyrrolidine;hydrochloride (CAS 174213-52-6) is a chemical compound with the molecular formula C11H16ClNO and a molecular weight of 213.70 g/mol. IUPAC name: (2S)-2-(phenoxymethyl)pyrrolidine;hydrochloride. InChIKey: ZQZPNGMXJUGQPP-PPHPATTJSA-N.
| Molecular formula | C11H16ClNO |
|---|---|
| Molecular weight | 213.70 g/mol |
| IUPAC name | (2S)-2-(phenoxymethyl)pyrrolidine;hydrochloride |
| InChIKey | ZQZPNGMXJUGQPP-PPHPATTJSA-N |
| SMILES | C1C[C@H](NC1)COC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)