CAS 17434-81-0 is the registry number for 3′-Deoxy-5′-AMP. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(2S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxyoxolan-2-yl]methyl dihydrogen phosphate (CAS 17434-81-0) is a chemical compound with the molecular formula C10H14N5O6P and a molecular weight of 331.22 g/mol. IUPAC name: [(2S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxyoxolan-2-yl]methyl dihydrogen phosphate. InChIKey: XKFCKNDXVMFENB-BAJZRUMYSA-N.
| Molecular formula | C10H14N5O6P |
|---|---|
| Molecular weight | 331.22 g/mol |
| IUPAC name | [(2S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| InChIKey | XKFCKNDXVMFENB-BAJZRUMYSA-N |
| SMILES | C1[C@H](O[C@H]([C@@H]1O)N2C=NC3=C(N=CN=C32)N)COP(=O)(O)O |
Computed by PubChem (NCBI)