CAS 85956-71-4 appears in our catalog under these names: 2`,3`-Dideoxy-5`-guanylic Acid, 2',3'-Dideoxyguanosine-5'-triphosphate. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 5ug, 1ug, 10ug.
[(2S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl dihydrogen phosphate (CAS 85956-71-4) is a chemical compound with the molecular formula C10H14N5O6P and a molecular weight of 331.22 g/mol. IUPAC name: [(2S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl dihydrogen phosphate. InChIKey: SDMRBYKCQICSIT-NTSWFWBYSA-N.
| Molecular formula | C10H14N5O6P |
|---|---|
| Molecular weight | 331.22 g/mol |
| IUPAC name | [(2S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl dihydrogen phosphate |
| InChIKey | SDMRBYKCQICSIT-NTSWFWBYSA-N |
| SMILES | C1C[C@@H](O[C@@H]1COP(=O)(O)O)N2C=NC3=C2N=C(NC3=O)N |
Computed by PubChem (NCBI)