CAS 174356-08-2 appears in our catalog under these names: 2-(2-(Trifluoromethyl)phenyl)-1H-imidazole, 95+%, 2-(2-TRIFLUOROMETHYL-PHENYL)-1H-IMIDAZOLE, 95+%, 95+%. Offered by: Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg.
2-[2-(trifluoromethyl)phenyl]-1H-imidazole (CAS 174356-08-2) is a chemical compound with the molecular formula C10H7F3N2 and a molecular weight of 212.17 g/mol. IUPAC name: 2-[2-(trifluoromethyl)phenyl]-1H-imidazole. InChIKey: ADIDVEUHTIRRIM-UHFFFAOYSA-N.
| Molecular formula | C10H7F3N2 |
|---|---|
| Molecular weight | 212.17 g/mol |
| IUPAC name | 2-[2-(trifluoromethyl)phenyl]-1H-imidazole |
| InChIKey | ADIDVEUHTIRRIM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC=CN2)C(F)(F)F |
Computed by PubChem (NCBI)