CAS 174466-64-9 is the registry number for (4S)-4-(Propan-2-yl)-1λâ¶,2,5-thiadiazolidine-1,1,3-trione. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(4S)-1,1-dioxo-4-propan-2-yl-1,2,5-thiadiazolidin-3-one (CAS 174466-64-9) is a chemical compound with the molecular formula C5H10N2O3S and a molecular weight of 178.21 g/mol. IUPAC name: (4S)-1,1-dioxo-4-propan-2-yl-1,2,5-thiadiazolidin-3-one. InChIKey: ARGDYBLGWYGDMM-BYPYZUCNSA-N.
| Molecular formula | C5H10N2O3S |
|---|---|
| Molecular weight | 178.21 g/mol |
| IUPAC name | (4S)-1,1-dioxo-4-propan-2-yl-1,2,5-thiadiazolidin-3-one |
| InChIKey | ARGDYBLGWYGDMM-BYPYZUCNSA-N |
| SMILES | CC(C)[C@H]1C(=O)NS(=O)(=O)N1 |
Computed by PubChem (NCBI)