CAS 17451-61-5 appears in our catalog under these names: Bzl-His-OH, (S)-2-(Benzylamino)-3-(1H-imidazol-4-yl)propanoic acid, 95%, 95%. Offered by: Creative Peptides, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
(2S)-2-(benzylamino)-3-(1H-imidazol-5-yl)propanoic acid (CAS 17451-61-5) is a chemical compound with the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. IUPAC name: (2S)-2-(benzylamino)-3-(1H-imidazol-5-yl)propanoic acid. InChIKey: FOYXZVHDLXZETB-LBPRGKRZSA-N.
| Molecular formula | C13H15N3O2 |
|---|---|
| Molecular weight | 245.28 g/mol |
| IUPAC name | (2S)-2-(benzylamino)-3-(1H-imidazol-5-yl)propanoic acid |
| InChIKey | FOYXZVHDLXZETB-LBPRGKRZSA-N |
| SMILES | C1=CC=C(C=C1)CN[C@@H](CC2=CN=CN2)C(=O)O |
Computed by PubChem (NCBI)