CAS 174579-99-8 appears in our catalog under these names: 4-(1,1-Dimethylethyl)benzoyl fluoride, ≥97-<99%, 4-(1,1-Dimethylethyl)benzoyl fluoride, 95-<97%, 4-(tert-Butyl)benzoyl fluoride, 98%, 98%, 4-(1,1-Dimethylethyl)benzoyl fluoride, 95%, 4-(tert-Butyl)benzoyl fluoride, 97%. Offered by: Hoffman Fine Chemicals, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 50g, 100g, 200g, 300g, 400g, 100mg, 250mg.
4-tert-butylbenzoyl fluoride (CAS 174579-99-8) is a chemical compound with the molecular formula C11H13FO and a molecular weight of 180.22 g/mol. IUPAC name: 4-tert-butylbenzoyl fluoride. InChIKey: XPVHEVIAWLGIOT-UHFFFAOYSA-N.
| Molecular formula | C11H13FO |
|---|---|
| Molecular weight | 180.22 g/mol |
| IUPAC name | 4-tert-butylbenzoyl fluoride |
| InChIKey | XPVHEVIAWLGIOT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(=O)F |
Computed by PubChem (NCBI)