CAS 62681-85-0 is the registry number for 1-(3-Fluorophenyl)-2,2-dimethylpropan-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-(3-fluorophenyl)-2,2-dimethylpropan-1-one (CAS 62681-85-0) is a chemical compound with the molecular formula C11H13FO and a molecular weight of 180.22 g/mol. IUPAC name: 1-(3-fluorophenyl)-2,2-dimethylpropan-1-one. InChIKey: UQSOTBCAPUHYBF-UHFFFAOYSA-N.
| Molecular formula | C11H13FO |
|---|---|
| Molecular weight | 180.22 g/mol |
| IUPAC name | 1-(3-fluorophenyl)-2,2-dimethylpropan-1-one |
| InChIKey | UQSOTBCAPUHYBF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)C1=CC(=CC=C1)F |
Computed by PubChem (NCBI)