CAS 174636-94-3 appears in our catalog under these names: ((2R)-2-Amino-2-phenylethyl)dimethylamine, (R)-N1,N1-Dimethyl-2-phenylethane-1,2-diamine, 95%, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 100mg, 1g, 250mg.
(1R)-N',N'-dimethyl-1-phenylethane-1,2-diamine (CAS 174636-94-3) is a chemical compound with the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. IUPAC name: (1R)-N',N'-dimethyl-1-phenylethane-1,2-diamine. InChIKey: NPGAXSHDDOESHB-JTQLQIEISA-N.
| Molecular formula | C10H16N2 |
|---|---|
| Molecular weight | 164.25 g/mol |
| IUPAC name | (1R)-N',N'-dimethyl-1-phenylethane-1,2-diamine |
| InChIKey | NPGAXSHDDOESHB-JTQLQIEISA-N |
| SMILES | CN(C)C[C@@H](C1=CC=CC=C1)N |
Computed by PubChem (NCBI)