CAS 702699-84-1 appears in our catalog under these names: N–((2S)–2–Amino–2–phenylethyl)–N,N–dimethylamine, N-((2S)-2-Amino-2-phenylethyl)-N,N-dimethylamine, 95%, 95%, N-((2S)-2-Amino-2-phenylethyl)-N,N-dimethylamine, 97.85%, N-((2S)-2-Amino-2-phenylethyl)-N,N-dimethylamine, 95%. Offered by: GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 100 mg, 250 mg, 1 g, 500 mg.
(1S)-N',N'-dimethyl-1-phenylethane-1,2-diamine (CAS 702699-84-1) is a chemical compound with the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. IUPAC name: (1S)-N',N'-dimethyl-1-phenylethane-1,2-diamine. InChIKey: NPGAXSHDDOESHB-SNVBAGLBSA-N.
| Molecular formula | C10H16N2 |
|---|---|
| Molecular weight | 164.25 g/mol |
| IUPAC name | (1S)-N',N'-dimethyl-1-phenylethane-1,2-diamine |
| InChIKey | NPGAXSHDDOESHB-SNVBAGLBSA-N |
| SMILES | CN(C)C[C@H](C1=CC=CC=C1)N |
Computed by PubChem (NCBI)