Products 174727-04-9
CAS 174727-04-9 appears in our catalog under these names: tert-Butyl (3s,4s)-4-methoxypyrrolidin-3-yl(methyl)carbamate, 95%, (4-Methoxy-pyrrolidin-3-yl)methyl-carbamic acid tert-butyl ester, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg, 10g.
Tert-butyl N-[(3S,4S)-4-methoxypyrrolidin-3-yl]-N-methylcarbamate (CAS 174727-04-9) is a chemical compound with the molecular formula C11H22N2O3 and a molecular weight of 230.30 g/mol. IUPAC name: tert-butyl N-[(3S,4S)-4-methoxypyrrolidin-3-yl]-N-methylcarbamate. InChIKey: YPHNEEGTSORGGI-IUCAKERBSA-N.
| Molecular formula | C11H22N2O3 |
|---|---|
| Molecular weight | 230.30 g/mol |
| IUPAC name | tert-butyl N-[(3S,4S)-4-methoxypyrrolidin-3-yl]-N-methylcarbamate |
| InChIKey | YPHNEEGTSORGGI-IUCAKERBSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)[C@H]1CNC[C@@H]1OC |
Computed by PubChem (NCBI)