CAS 174732-77-5 appears in our catalog under these names: 2-amino-3-[4-(trifluoromethoxy)phenyl]propanoic acid hydrochloride, 95%, 2-Amino-3-(4-(trifluoromethoxy)phenyl)propanoic acid hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g.
2-amino-3-[4-(trifluoromethoxy)phenyl]propanoic acid;hydrochloride (CAS 174732-77-5) is a chemical compound with the molecular formula C10H11ClF3NO3 and a molecular weight of 285.65 g/mol. IUPAC name: 2-amino-3-[4-(trifluoromethoxy)phenyl]propanoic acid;hydrochloride. InChIKey: UAKYDNOGIWVOQQ-UHFFFAOYSA-N.
| Molecular formula | C10H11ClF3NO3 |
|---|---|
| Molecular weight | 285.65 g/mol |
| IUPAC name | 2-amino-3-[4-(trifluoromethoxy)phenyl]propanoic acid;hydrochloride |
| InChIKey | UAKYDNOGIWVOQQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(C(=O)O)N)OC(F)(F)F.Cl |
Computed by PubChem (NCBI)