CAS 921609-34-9 appears in our catalog under these names: (2S)-2-Amino-3-[4-(trifluoromethoxy)phenyl]propanoic acid hydrochloride, 95%, (S)–2–Amino–3–(4–(trifluoromethoxy)phenyl)propanoic acid hydrochloride, H-L-Phe(4-OCF3)-OH, (S)-2-Amino-3-(4-(trifluoromethoxy)phenyl)propanoic acid hydrochloride, 95%, 95%, (S)-2-AMINO-3-(4-(TRIFLUOROMETHOXY)PHENYL)PROPANOIC ACID HCL, 98%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
(2S)-2-amino-3-[4-(trifluoromethoxy)phenyl]propanoic acid;hydrochloride (CAS 921609-34-9) is a chemical compound with the molecular formula C10H11ClF3NO3 and a molecular weight of 285.65 g/mol. IUPAC name: (2S)-2-amino-3-[4-(trifluoromethoxy)phenyl]propanoic acid;hydrochloride. InChIKey: UAKYDNOGIWVOQQ-QRPNPIFTSA-N.
| Molecular formula | C10H11ClF3NO3 |
|---|---|
| Molecular weight | 285.65 g/mol |
| IUPAC name | (2S)-2-amino-3-[4-(trifluoromethoxy)phenyl]propanoic acid;hydrochloride |
| InChIKey | UAKYDNOGIWVOQQ-QRPNPIFTSA-N |
| SMILES | C1=CC(=CC=C1C[C@@H](C(=O)O)N)OC(F)(F)F.Cl |
Computed by PubChem (NCBI)