Products 174736-88-0
CAS 174736-88-0 is the registry number for 2-Methyl-d3-propionitrile-3,3,3-d3, 99 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 1g, 0,5g.
3,3,3-trideuterio-2-(trideuteriomethyl)propanenitrile (CAS 174736-88-0) is a chemical compound with the molecular formula C4H7N and a molecular weight of 75.14 g/mol. IUPAC name: 3,3,3-trideuterio-2-(trideuteriomethyl)propanenitrile. InChIKey: LRDFRRGEGBBSRN-WFGJKAKNSA-N.
| Molecular formula | C4H7N |
|---|---|
| Molecular weight | 75.14 g/mol |
| IUPAC name | 3,3,3-trideuterio-2-(trideuteriomethyl)propanenitrile |
| InChIKey | LRDFRRGEGBBSRN-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C(C#N)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)