Products 352431-11-9

CAS 352431-11-9 is the registry number for Butyronitrile-d7, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,1g, 0,05g.

Structural formula: {0} (CAS {1})

2,2,3,3,4,4,4-heptadeuteriobutanenitrile (CAS 352431-11-9) is a chemical compound with the molecular formula C4H7N and a molecular weight of 76.15 g/mol. IUPAC name: 2,2,3,3,4,4,4-heptadeuteriobutanenitrile. InChIKey: KVNRLNFWIYMESJ-NCKGIQLSSA-N.

Identity
Molecular formulaC4H7N
Molecular weight76.15 g/mol
IUPAC name2,2,3,3,4,4,4-heptadeuteriobutanenitrile
InChIKeyKVNRLNFWIYMESJ-NCKGIQLSSA-N
SMILES[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C#N

Computed by PubChem (NCBI)