CAS 352431-11-9 is the registry number for Butyronitrile-d7, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,1g, 0,05g.
2,2,3,3,4,4,4-heptadeuteriobutanenitrile (CAS 352431-11-9) is a chemical compound with the molecular formula C4H7N and a molecular weight of 76.15 g/mol. IUPAC name: 2,2,3,3,4,4,4-heptadeuteriobutanenitrile. InChIKey: KVNRLNFWIYMESJ-NCKGIQLSSA-N.
| Molecular formula | C4H7N |
|---|---|
| Molecular weight | 76.15 g/mol |
| IUPAC name | 2,2,3,3,4,4,4-heptadeuteriobutanenitrile |
| InChIKey | KVNRLNFWIYMESJ-NCKGIQLSSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C#N |
Computed by PubChem (NCBI)