CAS 174959-54-7 appears in our catalog under these names: tert–Butyl 4–aminobenzylcarbamate hydrochloride, tert-Butyl 4-aminobenzylcarbamate hydrochloride, 95%, 95%, tert-Butyl 4-aminobenzylcarbamate hydrochloride, 98%, tert-Butyl 4-aminobenzylcarbamate hydrochloride, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g.
Tert-butyl N-[(4-aminophenyl)methyl]carbamate;hydrochloride (CAS 174959-54-7) is a chemical compound with the molecular formula C12H19ClN2O2 and a molecular weight of 258.74 g/mol. IUPAC name: tert-butyl N-[(4-aminophenyl)methyl]carbamate;hydrochloride. InChIKey: UULGYZXPISSQLH-UHFFFAOYSA-N.
| Molecular formula | C12H19ClN2O2 |
|---|---|
| Molecular weight | 258.74 g/mol |
| IUPAC name | tert-butyl N-[(4-aminophenyl)methyl]carbamate;hydrochloride |
| InChIKey | UULGYZXPISSQLH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=CC=C(C=C1)N.Cl |
Computed by PubChem (NCBI)