CAS 1750-07-8 is the registry number for Nortriptyline Impurity 1 HCl. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl-[3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)propyl]azanium chloride (CAS 1750-07-8) is a chemical compound with the molecular formula C19H24ClN and a molecular weight of 301.9 g/mol. IUPAC name: methyl-[3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)propyl]azanium chloride. InChIKey: LXRLABSDZUKVGP-UHFFFAOYSA-N.
| Molecular formula | C19H24ClN |
|---|---|
| Molecular weight | 301.9 g/mol |
| IUPAC name | methyl-[3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)propyl]azanium chloride |
| InChIKey | LXRLABSDZUKVGP-UHFFFAOYSA-N |
| SMILES | C[NH2+]CCCC1C2=CC=CC=C2CCC3=CC=CC=C13.[Cl-] |
Computed by PubChem (NCBI)