CAS 2448337-90-2 is the registry number for 2,2,4-Trimethyl-4-(4-methylphenyl)-1,2,3,4-tetrahydroquinoline hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2,2,4-trimethyl-4-(4-methylphenyl)-1,3-dihydroquinoline;hydrochloride (CAS 2448337-90-2) is a chemical compound with the molecular formula C19H24ClN and a molecular weight of 301.9 g/mol. IUPAC name: 2,2,4-trimethyl-4-(4-methylphenyl)-1,3-dihydroquinoline;hydrochloride. InChIKey: DLEILVNGMYLFGW-UHFFFAOYSA-N.
| Molecular formula | C19H24ClN |
|---|---|
| Molecular weight | 301.9 g/mol |
| IUPAC name | 2,2,4-trimethyl-4-(4-methylphenyl)-1,3-dihydroquinoline;hydrochloride |
| InChIKey | DLEILVNGMYLFGW-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2(CC(NC3=CC=CC=C32)(C)C)C.Cl |
Computed by PubChem (NCBI)