CAS 17510-83-7 appears in our catalog under these names: 4-Nitrothiophene-2-sulfonamide, 95%, 4-Nitrothiophene-2-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
4-nitrothiophene-2-sulfonamide (CAS 17510-83-7) is a chemical compound with the molecular formula C4H4N2O4S2 and a molecular weight of 208.2 g/mol. IUPAC name: 4-nitrothiophene-2-sulfonamide. InChIKey: RHRBWSCTTUHORC-UHFFFAOYSA-N.
| Molecular formula | C4H4N2O4S2 |
|---|---|
| Molecular weight | 208.2 g/mol |
| IUPAC name | 4-nitrothiophene-2-sulfonamide |
| InChIKey | RHRBWSCTTUHORC-UHFFFAOYSA-N |
| SMILES | C1=C(SC=C1[N+](=O)[O-])S(=O)(=O)N |
Computed by PubChem (NCBI)