CAS 89032-84-8 appears in our catalog under these names: 2-Sulfamoylthiazole-4-carboxylic acid, 95%, 2-Sulfamoyl-1,3-thiazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,05g, 0,025g, 0,1g, 0,25g.
2-sulfamoyl-1,3-thiazole-4-carboxylic acid (CAS 89032-84-8) is a chemical compound with the molecular formula C4H4N2O4S2 and a molecular weight of 208.2 g/mol. IUPAC name: 2-sulfamoyl-1,3-thiazole-4-carboxylic acid. InChIKey: NGHURPFTAUWMLK-UHFFFAOYSA-N.
| Molecular formula | C4H4N2O4S2 |
|---|---|
| Molecular weight | 208.2 g/mol |
| IUPAC name | 2-sulfamoyl-1,3-thiazole-4-carboxylic acid |
| InChIKey | NGHURPFTAUWMLK-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(S1)S(=O)(=O)N)C(=O)O |
Computed by PubChem (NCBI)