Products 17511-60-3

CAS 17511-60-3 is the registry number for 3a,4,5,6,7,7a-Hexahydro-1H-4,7-methanoinden-6-yl propionate, 90%. Offered by: Fluorochem, Ambeed. Available pack sizes: 25g, 100g, 500g, 1kg.

Structural formula: {0} (CAS {1})

8-tricyclo[5.2.1.02,6]dec-3-enyl propanoate (CAS 17511-60-3) is a chemical compound with the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. IUPAC name: 8-tricyclo[5.2.1.02,6]dec-3-enyl propanoate. InChIKey: BLBJUGKATXCWET-UHFFFAOYSA-N.

Identity
Molecular formulaC13H18O2
Molecular weight206.28 g/mol
IUPAC name8-tricyclo[5.2.1.02,6]dec-3-enyl propanoate
InChIKeyBLBJUGKATXCWET-UHFFFAOYSA-N
SMILESCCC(=O)OC1CC2CC1C3C2C=CC3

Computed by PubChem (NCBI)