CAS 175134-99-3 appears in our catalog under these names: 3-Amino-4-(4-chloro-3,5-dimethylphenoxy)benzotrifluoride, 95%, 3-Amino-4-(4-chloro-3,5-dimethylphenoxy)-benzotrifluoride, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g.
2-(4-chloro-3,5-dimethylphenoxy)-5-(trifluoromethyl)aniline (CAS 175134-99-3) is a chemical compound with the molecular formula C15H13ClF3NO and a molecular weight of 315.72 g/mol. IUPAC name: 2-(4-chloro-3,5-dimethylphenoxy)-5-(trifluoromethyl)aniline. InChIKey: FRFHKLYQWNKCPQ-UHFFFAOYSA-N.
| Molecular formula | C15H13ClF3NO |
|---|---|
| Molecular weight | 315.72 g/mol |
| IUPAC name | 2-(4-chloro-3,5-dimethylphenoxy)-5-(trifluoromethyl)aniline |
| InChIKey | FRFHKLYQWNKCPQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1Cl)C)OC2=C(C=C(C=C2)C(F)(F)F)N |
Computed by PubChem (NCBI)