CAS 314245-30-2 is the registry number for 1-Ethanone, 2-chloro-1-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]-1h-pyrrol-3-yl]-, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg, 10g.
2-chloro-1-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]ethanone (CAS 314245-30-2) is a chemical compound with the molecular formula C15H13ClF3NO and a molecular weight of 315.72 g/mol. IUPAC name: 2-chloro-1-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]ethanone. InChIKey: DNYPNPGMOPUINU-UHFFFAOYSA-N.
| Molecular formula | C15H13ClF3NO |
|---|---|
| Molecular weight | 315.72 g/mol |
| IUPAC name | 2-chloro-1-[2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]ethanone |
| InChIKey | DNYPNPGMOPUINU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1C2=CC=CC(=C2)C(F)(F)F)C)C(=O)CCl |
Computed by PubChem (NCBI)